About 1,3,5-trifluoronaphthalene-2,6-diol
1,3,5-trifluoronaphthalene-2,6-diol (PubChem CID 18457184) has the molecular formula C10H5F3O2
and a molecular weight of 214.14 g/mol. Its IUPAC name is 1,3,5-trifluoronaphthalene-2,6-diol.
Molecular Properties
| Compound Name | 1,3,5-trifluoronaphthalene-2,6-diol |
| PubChem CID | 18457184 |
| Molecular Formula | C10H5F3O2 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 1,3,5-trifluoronaphthalene-2,6-diol |
| SMILES | Oc1ccc2c(F)c(O)c(F)cc2c1F |
| InChI | InChI=1S/C10H5F3O2/c11-6-3-5-4(9(13)10(6)15)1-2-7(14)8(5)12/h1-3,14-15H |
| InChIKey | VARCHHJMWGZKPA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3,5-trifluoronaphthalene-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trifluoronaphthalene-2,6-diol?
The IUPAC name of 1,3,5-trifluoronaphthalene-2,6-diol (CID 18457184) is 1,3,5-trifluoronaphthalene-2,6-diol.
What is the SMILES notation for 1,3,5-trifluoronaphthalene-2,6-diol?
The canonical SMILES for 1,3,5-trifluoronaphthalene-2,6-diol is Oc1ccc2c(F)c(O)c(F)cc2c1F.
What is the InChIKey of 1,3,5-trifluoronaphthalene-2,6-diol?
The InChIKey is VARCHHJMWGZKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3O2/c11-6-3-5-4(9(13)10(6)15)1-2-7(14)8(5)12/h1-3,14-15H.
What are the key properties of 1,3,5-trifluoronaphthalene-2,6-diol?
1,3,5-trifluoronaphthalene-2,6-diol has a molecular weight of 214.14 g/mol, XLogP of 2.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trifluoronaphthalene-2,6-diol is sourced from PubChem (CID 18457184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).