About 2,8-difluoronaphthalene-1,5-diamine
2,8-difluoronaphthalene-1,5-diamine (PubChem CID 18457200) has the molecular formula C10H8F2N2
and a molecular weight of 194.18 g/mol. Its IUPAC name is 2,8-difluoronaphthalene-1,5-diamine.
Molecular Properties
| Compound Name | 2,8-difluoronaphthalene-1,5-diamine |
| PubChem CID | 18457200 |
| Molecular Formula | C10H8F2N2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2,8-difluoronaphthalene-1,5-diamine |
| SMILES | Nc1ccc(F)c2c(N)c(F)ccc12 |
| InChI | InChI=1S/C10H8F2N2/c11-6-3-4-8(13)5-1-2-7(12)10(14)9(5)6/h1-4H,13-14H2 |
| InChIKey | KWIWXOPUXOUHNI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,8-difluoronaphthalene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-difluoronaphthalene-1,5-diamine?
The IUPAC name of 2,8-difluoronaphthalene-1,5-diamine (CID 18457200) is 2,8-difluoronaphthalene-1,5-diamine.
What is the SMILES notation for 2,8-difluoronaphthalene-1,5-diamine?
The canonical SMILES for 2,8-difluoronaphthalene-1,5-diamine is Nc1ccc(F)c2c(N)c(F)ccc12.
What is the InChIKey of 2,8-difluoronaphthalene-1,5-diamine?
The InChIKey is KWIWXOPUXOUHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N2/c11-6-3-4-8(13)5-1-2-7(12)10(14)9(5)6/h1-4H,13-14H2.
What are the key properties of 2,8-difluoronaphthalene-1,5-diamine?
2,8-difluoronaphthalene-1,5-diamine has a molecular weight of 194.18 g/mol, XLogP of 2.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-difluoronaphthalene-1,5-diamine is sourced from PubChem (CID 18457200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).