C53H54O10 — CID 18457728
dibenzyl 2-[2-[(3R,4S,5R,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]propanedioate (PubChem CID 18457728) has the molecular formula C53H54O10 and a molecular weight of 851.01 g/mol. Its IUPAC name is dibenzyl 2-[2-[(3R,4S,5R,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]propanedioate.
| Compound Name | dibenzyl 2-[2-[(3R,4S,5R,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 18457728 |
| Molecular Formula | C53H54O10 |
| Molecular Weight | 851.01 g/mol |
| Exact Mass | 850.37 |
| IUPAC Name | dibenzyl 2-[2-[(3R,4S,5R,6R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]propanedioate |
| SMILES | O=C(OCc1ccccc1)C(CCC1(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C53H54O10/c54-51(61-37-44-27-15-5-16-28-44)46(52(55)62-38-45-29-17-6-18-30-45)31-32-53(56)50(60-36-43-25-13-4-14-26-43)49(59-35-42-23-11-3-12-24-42)48(58-34-41-21-9-2-10-22-41)47(63-53)39-57-33-40-19-7-1-8-20-40/h1-30,46-50,56H,31-39H2/t47-,48-,49+,50-,53?/m1/s1 |
| InChIKey | AZHCLYVGQHZLPH-WXHSVKQHSA-N |
| XLogP | 8.93 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.01 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|