About dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium
dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 18457916) has the molecular formula C9H12N+
and a molecular weight of 134.20 g/mol. Its IUPAC name is dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| PubChem CID | 18457916 |
| Molecular Formula | C9H12N+ |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | C=C1C=CC(=[N+](C)C)C=C1 |
| InChI | InChI=1S/C9H12N/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1H2,2-3H3/q+1 |
| InChIKey | MAYYPORCWYLNEC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
The IUPAC name of dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium (CID 18457916) is dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium.
What is the SMILES notation for dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
The canonical SMILES for dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium is C=C1C=CC(=[N+](C)C)C=C1.
What is the InChIKey of dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
The InChIKey is MAYYPORCWYLNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1H2,2-3H3/q+1.
What are the key properties of dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium has a molecular weight of 134.20 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium is sourced from PubChem (CID 18457916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).