C12H22N4O6 — CID 18457953
2-methyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 18457953) has the molecular formula C12H22N4O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-methyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | 2-methyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 18457953 |
| Molecular Formula | C12H22N4O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-methyl-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | CC1CN(C(=O)O)CCN(C(=O)O)CCNCCN1C(=O)O |
| InChI | InChI=1S/C12H22N4O6/c1-9-8-15(11(19)20)7-6-14(10(17)18)4-2-13-3-5-16(9)12(21)22/h9,13H,2-8H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | MFBHUKBGTQZVFU-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |