C8H12F6I2 — CID 18458463
1,1,2,2,3,3-hexafluoro-1,3-diiodopropane;2-methylbutane (PubChem CID 18458463) has the molecular formula C8H12F6I2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1,3-diiodopropane;2-methylbutane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1,3-diiodopropane;2-methylbutane |
|---|---|
| PubChem CID | 18458463 |
| Molecular Formula | C8H12F6I2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.89 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1,3-diiodopropane;2-methylbutane |
| SMILES | CCC(C)C.FC(F)(I)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C5H12.C3F6I2/c1-4-5(2)3;4-1(5,2(6,7)10)3(8,9)11/h5H,4H2,1-3H3; |
| InChIKey | DAXYCBUZOCPMPH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|