About 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane
2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane (PubChem CID 18458590) has the molecular formula C7H14BNO2
and a molecular weight of 155.01 g/mol. Its IUPAC name is 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane.
Molecular Properties
| Compound Name | 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane |
| PubChem CID | 18458590 |
| Molecular Formula | C7H14BNO2 |
| Molecular Weight | 155.01 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane |
| SMILES | C=CB1OCCN(C)CCO1 |
| InChI | InChI=1S/C7H14BNO2/c1-3-8-10-6-4-9(2)5-7-11-8/h3H,1,4-7H2,2H3 |
| InChIKey | HTRAWQPTCWJCSZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.01 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane?
The IUPAC name of 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane (CID 18458590) is 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane.
What is the SMILES notation for 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane?
The canonical SMILES for 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane is C=CB1OCCN(C)CCO1.
What is the InChIKey of 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane?
The InChIKey is HTRAWQPTCWJCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BNO2/c1-3-8-10-6-4-9(2)5-7-11-8/h3H,1,4-7H2,2H3.
What are the key properties of 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane?
2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane has a molecular weight of 155.01 g/mol, XLogP of 0.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane is sourced from PubChem (CID 18458590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).