About 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione
3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione (PubChem CID 18458600) has the molecular formula C11H6N2O3
and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione.
Molecular Properties
| Compound Name | 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione |
| PubChem CID | 18458600 |
| Molecular Formula | C11H6N2O3 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione |
| SMILES | O=c1c(-c2ccccc2)cn2c(=O)n1c2=O |
| InChI | InChI=1S/C11H6N2O3/c14-9-8(7-4-2-1-3-5-7)6-12-10(15)13(9)11(12)16/h1-6H |
| InChIKey | WQTRKGOCJYCRNC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 60.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione?
The IUPAC name of 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione (CID 18458600) is 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione.
What is the SMILES notation for 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione?
The canonical SMILES for 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione is O=c1c(-c2ccccc2)cn2c(=O)n1c2=O.
What is the InChIKey of 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione?
The InChIKey is WQTRKGOCJYCRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O3/c14-9-8(7-4-2-1-3-5-7)6-12-10(15)13(9)11(12)16/h1-6H.
What are the key properties of 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione?
3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione has a molecular weight of 214.18 g/mol, XLogP of -0.34, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,5-diazabicyclo[3.1.1]hept-3-ene-2,6,7-trione is sourced from PubChem (CID 18458600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).