About dipropyl benzene-1,3-dicarboxylate
dipropyl benzene-1,3-dicarboxylate (PubChem CID 18459) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is dipropyl benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dipropyl benzene-1,3-dicarboxylate |
| PubChem CID | 18459 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | dipropyl benzene-1,3-dicarboxylate |
| SMILES | CCCOC(=O)c1cccc(C(=O)OCCC)c1 |
| InChI | InChI=1S/C14H18O4/c1-3-8-17-13(15)11-6-5-7-12(10-11)14(16)18-9-4-2/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | FZNKCFJDFGDMKU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipropyl benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropyl benzene-1,3-dicarboxylate?
The IUPAC name of dipropyl benzene-1,3-dicarboxylate (CID 18459) is dipropyl benzene-1,3-dicarboxylate.
What is the SMILES notation for dipropyl benzene-1,3-dicarboxylate?
The canonical SMILES for dipropyl benzene-1,3-dicarboxylate is CCCOC(=O)c1cccc(C(=O)OCCC)c1.
What is the InChIKey of dipropyl benzene-1,3-dicarboxylate?
The InChIKey is FZNKCFJDFGDMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-3-8-17-13(15)11-6-5-7-12(10-11)14(16)18-9-4-2/h5-7,10H,3-4,8-9H2,1-2H3.
What are the key properties of dipropyl benzene-1,3-dicarboxylate?
dipropyl benzene-1,3-dicarboxylate has a molecular weight of 250.29 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipropyl benzene-1,3-dicarboxylate is sourced from PubChem (CID 18459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).