C19H20N4O7S — CID 18459288
N,2-dihydroxy-2-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-(4-pyridin-4-ylphenyl)sulfonylpropanamide (PubChem CID 18459288) has the molecular formula C19H20N4O7S and a molecular weight of 448.46 g/mol. Its IUPAC name is N,2-dihydroxy-2-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-(4-pyridin-4-ylphenyl)sulfonylpropanamide.
| Compound Name | N,2-dihydroxy-2-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-(4-pyridin-4-ylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 18459288 |
| Molecular Formula | C19H20N4O7S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N,2-dihydroxy-2-[(3-methyl-2,5-dioxoimidazolidin-1-yl)methyl]-3-(4-pyridin-4-ylphenyl)sulfonylpropanamide |
| SMILES | CN1CC(=O)N(CC(O)(CS(=O)(=O)c2ccc(-c3ccncc3)cc2)C(=O)NO)C1=O |
| InChI | InChI=1S/C19H20N4O7S/c1-22-10-16(24)23(18(22)26)11-19(27,17(25)21-28)12-31(29,30)15-4-2-13(3-5-15)14-6-8-20-9-7-14/h2-9,27-28H,10-12H2,1H3,(H,21,25) |
| InChIKey | BYFMKHJXCGOXPP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|