C21H24N4O7S — CID 18459326
N,2-dihydroxy-2-[(4-pyridin-4-ylphenyl)sulfonylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 18459326) has the molecular formula C21H24N4O7S and a molecular weight of 476.51 g/mol. Its IUPAC name is N,2-dihydroxy-2-[(4-pyridin-4-ylphenyl)sulfonylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | N,2-dihydroxy-2-[(4-pyridin-4-ylphenyl)sulfonylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 18459326 |
| Molecular Formula | C21H24N4O7S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N,2-dihydroxy-2-[(4-pyridin-4-ylphenyl)sulfonylmethyl]-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | CN1C(=O)N(CC(O)(CS(=O)(=O)c2ccc(-c3ccncc3)cc2)C(=O)NO)C(=O)C1(C)C |
| InChI | InChI=1S/C21H24N4O7S/c1-20(2)18(27)25(19(28)24(20)3)12-21(29,17(26)23-30)13-33(31,32)16-6-4-14(5-7-16)15-8-10-22-11-9-15/h4-11,29-30H,12-13H2,1-3H3,(H,23,26) |
| InChIKey | ASIQWNJHKYBDIE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|