About 1-octylcyclohexan-1-ol;oxirane
1-octylcyclohexan-1-ol;oxirane (PubChem CID 18459388) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-octylcyclohexan-1-ol;oxirane.
Molecular Properties
| Compound Name | 1-octylcyclohexan-1-ol;oxirane |
| PubChem CID | 18459388 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 1-octylcyclohexan-1-ol;oxirane |
| SMILES | C1CO1.CCCCCCCCC1(O)CCCCC1 |
| InChI | InChI=1S/C14H28O.C2H4O/c1-2-3-4-5-6-8-11-14(15)12-9-7-10-13-14;1-2-3-1/h15H,2-13H2,1H3;1-2H2 |
| InChIKey | OTGFXUAYHZKMFA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-octylcyclohexan-1-ol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylcyclohexan-1-ol;oxirane?
The IUPAC name of 1-octylcyclohexan-1-ol;oxirane (CID 18459388) is 1-octylcyclohexan-1-ol;oxirane.
What is the SMILES notation for 1-octylcyclohexan-1-ol;oxirane?
The canonical SMILES for 1-octylcyclohexan-1-ol;oxirane is C1CO1.CCCCCCCCC1(O)CCCCC1.
What is the InChIKey of 1-octylcyclohexan-1-ol;oxirane?
The InChIKey is OTGFXUAYHZKMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O.C2H4O/c1-2-3-4-5-6-8-11-14(15)12-9-7-10-13-14;1-2-3-1/h15H,2-13H2,1H3;1-2H2.
What are the key properties of 1-octylcyclohexan-1-ol;oxirane?
1-octylcyclohexan-1-ol;oxirane has a molecular weight of 256.43 g/mol, XLogP of 4.45, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylcyclohexan-1-ol;oxirane is sourced from PubChem (CID 18459388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).