About 4-methoxy-2,3-dihydro-1H-indol-5-ol
4-methoxy-2,3-dihydro-1H-indol-5-ol (PubChem CID 18459479) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydro-1H-indol-5-ol.
Molecular Properties
| Compound Name | 4-methoxy-2,3-dihydro-1H-indol-5-ol |
| PubChem CID | 18459479 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-methoxy-2,3-dihydro-1H-indol-5-ol |
| SMILES | COc1c(O)ccc2c1CCN2 |
| InChI | InChI=1S/C9H11NO2/c1-12-9-6-4-5-10-7(6)2-3-8(9)11/h2-3,10-11H,4-5H2,1H3 |
| InChIKey | VEDQXZZJBRBSRM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2,3-dihydro-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-dihydro-1H-indol-5-ol?
The IUPAC name of 4-methoxy-2,3-dihydro-1H-indol-5-ol (CID 18459479) is 4-methoxy-2,3-dihydro-1H-indol-5-ol.
What is the SMILES notation for 4-methoxy-2,3-dihydro-1H-indol-5-ol?
The canonical SMILES for 4-methoxy-2,3-dihydro-1H-indol-5-ol is COc1c(O)ccc2c1CCN2.
What is the InChIKey of 4-methoxy-2,3-dihydro-1H-indol-5-ol?
The InChIKey is VEDQXZZJBRBSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-12-9-6-4-5-10-7(6)2-3-8(9)11/h2-3,10-11H,4-5H2,1H3.
What are the key properties of 4-methoxy-2,3-dihydro-1H-indol-5-ol?
4-methoxy-2,3-dihydro-1H-indol-5-ol has a molecular weight of 165.19 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dihydro-1H-indol-5-ol is sourced from PubChem (CID 18459479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).