About Phosphocyclopentadiene
Phosphocyclopentadiene (PubChem CID 18459630) has the molecular formula C5H5O2P
and a molecular weight of 128.07 g/mol.
Molecular Properties
| Compound Name | Phosphocyclopentadiene |
| PubChem CID | 18459630 |
| Molecular Formula | C5H5O2P |
| Molecular Weight | 128.07 g/mol |
| Exact Mass | 128.00 |
| IUPAC Name | — |
| SMILES | O=P(=O)C1=CC=CC1 |
| InChI | InChI=1S/C5H5O2P/c6-8(7)5-3-1-2-4-5/h1-3H,4H2 |
| InChIKey | HFBFHSZJGYITHA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.07 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Phosphocyclopentadiene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phosphocyclopentadiene?
The IUPAC name of Phosphocyclopentadiene (CID 18459630) is not available.
What is the SMILES notation for Phosphocyclopentadiene?
The canonical SMILES for Phosphocyclopentadiene is O=P(=O)C1=CC=CC1.
What is the InChIKey of Phosphocyclopentadiene?
The InChIKey is HFBFHSZJGYITHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5O2P/c6-8(7)5-3-1-2-4-5/h1-3H,4H2.
What are the key properties of Phosphocyclopentadiene?
Phosphocyclopentadiene has a molecular weight of 128.07 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Phosphocyclopentadiene is sourced from PubChem (CID 18459630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).