C21H31N5 — CID 18459724
7-ethyl-2-methyl-1,4-bis(5-methyl-2-pyridinyl)-1,4,7-triazonane (PubChem CID 18459724) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 7-ethyl-2-methyl-1,4-bis(5-methyl-2-pyridinyl)-1,4,7-triazonane.
| Compound Name | 7-ethyl-2-methyl-1,4-bis(5-methyl-2-pyridinyl)-1,4,7-triazonane |
|---|---|
| PubChem CID | 18459724 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 7-ethyl-2-methyl-1,4-bis(5-methyl-2-pyridinyl)-1,4,7-triazonane |
| SMILES | CCN1CCN(c2ccc(C)cn2)CC(C)N(c2ccc(C)cn2)CC1 |
| InChI | InChI=1S/C21H31N5/c1-5-24-10-12-25(20-8-6-17(2)14-22-20)16-19(4)26(13-11-24)21-9-7-18(3)15-23-21/h6-9,14-15,19H,5,10-13,16H2,1-4H3 |
| InChIKey | UOEGJKVENRKUMV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |