C17H10F3N5O3S — CID 18460081
N-[(3-nitrophenyl)methyl]-2-(1,2-oxazol-5-yl)-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460081) has the molecular formula C17H10F3N5O3S and a molecular weight of 421.36 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-2-(1,2-oxazol-5-yl)-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(3-nitrophenyl)methyl]-2-(1,2-oxazol-5-yl)-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18460081 |
| Molecular Formula | C17H10F3N5O3S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-2-(1,2-oxazol-5-yl)-6-(trifluoromethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2nc(-c3ccno3)nc3sc(C(F)(F)F)cc23)c1 |
| InChI | InChI=1S/C17H10F3N5O3S/c18-17(19,20)13-7-11-14(21-8-9-2-1-3-10(6-9)25(26)27)23-15(24-16(11)29-13)12-4-5-22-28-12/h1-7H,8H2,(H,21,23,24) |
| InChIKey | QVIAWRDDIVBQEX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|