About N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine
N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460199) has the molecular formula C13H9Cl2N3S
and a molecular weight of 310.21 g/mol. Its IUPAC name is N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 18460199 |
| Molecular Formula | C13H9Cl2N3S |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1nc(NCc2ccccc2)c2cc(Cl)sc2n1 |
| InChI | InChI=1S/C13H9Cl2N3S/c14-10-6-9-11(17-13(15)18-12(9)19-10)16-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,16,17,18) |
| InChIKey | SIWGEPFTQFDTJA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine (CID 18460199) is N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine is Clc1nc(NCc2ccccc2)c2cc(Cl)sc2n1.
What is the InChIKey of N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine?
The InChIKey is SIWGEPFTQFDTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2N3S/c14-10-6-9-11(17-13(15)18-12(9)19-10)16-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,16,17,18).
What are the key properties of N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine?
N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine has a molecular weight of 310.21 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,6-dichlorothieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 18460199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).