About N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine
N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 18460354) has the molecular formula C16H10FN5O3S
and a molecular weight of 371.35 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 18460354 |
| Molecular Formula | C16H10FN5O3S |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(NCc3ccc(F)cc3)nc(-c3ccno3)nc2s1 |
| InChI | InChI=1S/C16H10FN5O3S/c17-10-3-1-9(2-4-10)8-18-14-11-7-13(22(23)24)26-16(11)21-15(20-14)12-5-6-19-25-12/h1-7H,8H2,(H,18,20,21) |
| InChIKey | MVROYFIXXUQUSJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine (CID 18460354) is N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine is O=[N+]([O-])c1cc2c(NCc3ccc(F)cc3)nc(-c3ccno3)nc2s1.
What is the InChIKey of N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is MVROYFIXXUQUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN5O3S/c17-10-3-1-9(2-4-10)8-18-14-11-7-13(22(23)24)26-16(11)21-15(20-14)12-5-6-19-25-12/h1-7H,8H2,(H,18,20,21).
What are the key properties of N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 371.35 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorophenyl)methyl]-6-nitro-2-(1,2-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 18460354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).