About N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride (PubChem CID 18460654) has the molecular formula C19H23Cl2FN4S
and a molecular weight of 429.39 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride |
| PubChem CID | 18460654 |
| Molecular Formula | C19H23Cl2FN4S |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(N2CCN(CCNc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C19H21FN4S.2ClH/c20-15-5-7-16(8-6-15)24-13-11-23(12-14-24)10-9-21-19-22-17-3-1-2-4-18(17)25-19;;/h1-8H,9-14H2,(H,21,22);2*1H |
| InChIKey | CONZRMAJFSOZJD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride?
The IUPAC name of N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride (CID 18460654) is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride.
What is the SMILES notation for N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride?
The canonical SMILES for N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride is Cl.Cl.Fc1ccc(N2CCN(CCNc3nc4ccccc4s3)CC2)cc1.
What is the InChIKey of N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride?
The InChIKey is CONZRMAJFSOZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN4S.2ClH/c20-15-5-7-16(8-6-15)24-13-11-23(12-14-24)10-9-21-19-22-17-3-1-2-4-18(17)25-19;;/h1-8H,9-14H2,(H,21,22);2*1H.
What are the key properties of N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride?
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride has a molecular weight of 429.39 g/mol, XLogP of 4.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazol-2-amine;dihydrochloride is sourced from PubChem (CID 18460654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).