C26H20N4O4S — CID 18461293
4-[[2-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3H-benzimidazol-5-yl]oxy]benzonitrile (PubChem CID 18461293) has the molecular formula C26H20N4O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is 4-[[2-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3H-benzimidazol-5-yl]oxy]benzonitrile.
| Compound Name | 4-[[2-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3H-benzimidazol-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 18461293 |
| Molecular Formula | C26H20N4O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-[[2-[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-3H-benzimidazol-5-yl]oxy]benzonitrile |
| SMILES | CC(Oc1ccc(CC2SC(=O)NC2=O)cc1)c1nc2ccc(Oc3ccc(C#N)cc3)cc2[nH]1 |
| InChI | InChI=1S/C26H20N4O4S/c1-15(33-18-6-2-16(3-7-18)12-23-25(31)30-26(32)35-23)24-28-21-11-10-20(13-22(21)29-24)34-19-8-4-17(14-27)5-9-19/h2-11,13,15,23H,12H2,1H3,(H,28,29)(H,30,31,32) |
| InChIKey | UGZYBEMALVTRNI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|