C35H35N3O4S — CID 18461295
5-[[4-[1-[6-[4-(1-adamantyl)phenoxy]-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 18461295) has the molecular formula C35H35N3O4S and a molecular weight of 593.75 g/mol. Its IUPAC name is 5-[[4-[1-[6-[4-(1-adamantyl)phenoxy]-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[1-[6-[4-(1-adamantyl)phenoxy]-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18461295 |
| Molecular Formula | C35H35N3O4S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 5-[[4-[1-[6-[4-(1-adamantyl)phenoxy]-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(Oc1ccc(CC2SC(=O)NC2=O)cc1)c1nc2ccc(Oc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc2[nH]1 |
| InChI | InChI=1S/C35H35N3O4S/c1-20(41-26-6-2-21(3-7-26)15-31-33(39)38-34(40)43-31)32-36-29-11-10-28(16-30(29)37-32)42-27-8-4-25(5-9-27)35-17-22-12-23(18-35)14-24(13-22)19-35/h2-11,16,20,22-24,31H,12-15,17-19H2,1H3,(H,36,37)(H,38,39,40) |
| InChIKey | YAVRGLPALSZNFP-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|