C13H7F5N2O3 — CID 18461402
N-methyl-2-nitro-5-(2,3,4,5,6-pentafluorophenoxy)aniline (PubChem CID 18461402) has the molecular formula C13H7F5N2O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is N-methyl-2-nitro-5-(2,3,4,5,6-pentafluorophenoxy)aniline.
| Compound Name | N-methyl-2-nitro-5-(2,3,4,5,6-pentafluorophenoxy)aniline |
|---|---|
| PubChem CID | 18461402 |
| Molecular Formula | C13H7F5N2O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-methyl-2-nitro-5-(2,3,4,5,6-pentafluorophenoxy)aniline |
| SMILES | CNc1cc(Oc2c(F)c(F)c(F)c(F)c2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H7F5N2O3/c1-19-6-4-5(2-3-7(6)20(21)22)23-13-11(17)9(15)8(14)10(16)12(13)18/h2-4,19H,1H3 |
| InChIKey | BSRJDZUELPEJSL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|