About tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate
tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate (PubChem CID 18461460) has the molecular formula C26H38N2O4
and a molecular weight of 442.60 g/mol. Its IUPAC name is tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate |
| PubChem CID | 18461460 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cc(Oc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)ccc1N |
| InChI | InChI=1S/C26H38N2O4/c1-24(2,3)18-13-17(14-19(22(18)29)25(4,5)6)31-16-11-12-20(27)21(15-16)28(10)23(30)32-26(7,8)9/h11-15,29H,27H2,1-10H3 |
| InChIKey | RGXJDIVNRAQUKN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate (CID 18461460) is tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate is CN(C(=O)OC(C)(C)C)c1cc(Oc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)ccc1N.
What is the InChIKey of tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate?
The InChIKey is RGXJDIVNRAQUKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38N2O4/c1-24(2,3)18-13-17(14-19(22(18)29)25(4,5)6)31-16-11-12-20(27)21(15-16)28(10)23(30)32-26(7,8)9/h11-15,29H,27H2,1-10H3.
What are the key properties of tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate?
tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate has a molecular weight of 442.60 g/mol, XLogP of 6.73, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-amino-5-(3,5-ditert-butyl-4-hydroxyphenoxy)phenyl]-N-methylcarbamate is sourced from PubChem (CID 18461460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).