About 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea
1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea (PubChem CID 18461650) has the molecular formula C22H27ClN2O5S
and a molecular weight of 466.99 g/mol. Its IUPAC name is 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea.
Molecular Properties
| Compound Name | 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea |
| PubChem CID | 18461650 |
| Molecular Formula | C22H27ClN2O5S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea |
| SMILES | COCC(=O)c1cccc(S(=O)(=O)NC(=O)Nc2c(C(C)C)cc(Cl)cc2C(C)C)c1 |
| InChI | InChI=1S/C22H27ClN2O5S/c1-13(2)18-10-16(23)11-19(14(3)4)21(18)24-22(27)25-31(28,29)17-8-6-7-15(9-17)20(26)12-30-5/h6-11,13-14H,12H2,1-5H3,(H2,24,25,27) |
| InChIKey | FZHHZMLWNLRREP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea?
The IUPAC name of 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea (CID 18461650) is 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea.
What is the SMILES notation for 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea?
The canonical SMILES for 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea is COCC(=O)c1cccc(S(=O)(=O)NC(=O)Nc2c(C(C)C)cc(Cl)cc2C(C)C)c1.
What is the InChIKey of 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea?
The InChIKey is FZHHZMLWNLRREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClN2O5S/c1-13(2)18-10-16(23)11-19(14(3)4)21(18)24-22(27)25-31(28,29)17-8-6-7-15(9-17)20(26)12-30-5/h6-11,13-14H,12H2,1-5H3,(H2,24,25,27).
What are the key properties of 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea?
1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea has a molecular weight of 466.99 g/mol, XLogP of 4.93, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-2,6-di(propan-2-yl)phenyl]-3-[3-(2-methoxyacetyl)phenyl]sulfonylurea is sourced from PubChem (CID 18461650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).