About 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene
3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene (PubChem CID 18461720) has the molecular formula C17H19NOS
and a molecular weight of 285.41 g/mol. Its IUPAC name is 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene.
Molecular Properties
| Compound Name | 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene |
| PubChem CID | 18461720 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene |
| SMILES | CC(C)c1cc(-c2ccsc2)cc(C(C)C)c1N=C=O |
| InChI | InChI=1S/C17H19NOS/c1-11(2)15-7-14(13-5-6-20-9-13)8-16(12(3)4)17(15)18-10-19/h5-9,11-12H,1-4H3 |
| InChIKey | YEKPQPIBVKMUOT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene?
The IUPAC name of 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene (CID 18461720) is 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene.
What is the SMILES notation for 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene?
The canonical SMILES for 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene is CC(C)c1cc(-c2ccsc2)cc(C(C)C)c1N=C=O.
What is the InChIKey of 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene?
The InChIKey is YEKPQPIBVKMUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NOS/c1-11(2)15-7-14(13-5-6-20-9-13)8-16(12(3)4)17(15)18-10-19/h5-9,11-12H,1-4H3.
What are the key properties of 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene?
3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene has a molecular weight of 285.41 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-isocyanato-3,5-di(propan-2-yl)phenyl]thiophene is sourced from PubChem (CID 18461720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).