About 1,3,3-trimethylazetidine
1,3,3-trimethylazetidine (PubChem CID 18461781) has the molecular formula C6H13N
and a molecular weight of 99.18 g/mol. Its IUPAC name is 1,3,3-trimethylazetidine.
Molecular Properties
| Compound Name | 1,3,3-trimethylazetidine |
| PubChem CID | 18461781 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | 1,3,3-trimethylazetidine |
| SMILES | CN1CC(C)(C)C1 |
| InChI | InChI=1S/C6H13N/c1-6(2)4-7(3)5-6/h4-5H2,1-3H3 |
| InChIKey | IOHJRUFWMYLKED-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3,3-trimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,3-trimethylazetidine?
The IUPAC name of 1,3,3-trimethylazetidine (CID 18461781) is 1,3,3-trimethylazetidine.
What is the SMILES notation for 1,3,3-trimethylazetidine?
The canonical SMILES for 1,3,3-trimethylazetidine is CN1CC(C)(C)C1.
What is the InChIKey of 1,3,3-trimethylazetidine?
The InChIKey is IOHJRUFWMYLKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N/c1-6(2)4-7(3)5-6/h4-5H2,1-3H3.
What are the key properties of 1,3,3-trimethylazetidine?
1,3,3-trimethylazetidine has a molecular weight of 99.18 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3-trimethylazetidine is sourced from PubChem (CID 18461781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).