C10H14N4O4 — CID 18461959
1-(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18461959) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18461959 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=C=NCCCCCCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N4O4/c15-7-11-5-3-1-2-4-6-14-9(17)12-8(16)13-10(14)18/h1-6H2,(H2,12,13,16,17,18) |
| InChIKey | TZIAVRBYAVKYDU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|