C26H23NO4 — CID 18462136
(8-benzoyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl) benzoate (PubChem CID 18462136) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is (8-benzoyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl) benzoate.
| Compound Name | (8-benzoyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl) benzoate |
|---|---|
| PubChem CID | 18462136 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (8-benzoyloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-yl) benzoate |
| SMILES | O=C(Oc1cc(OC(=O)c2ccccc2)c2c3c1CCCN3CCC2)c1ccccc1 |
| InChI | InChI=1S/C26H23NO4/c28-25(18-9-3-1-4-10-18)30-22-17-23(31-26(29)19-11-5-2-6-12-19)21-14-8-16-27-15-7-13-20(22)24(21)27/h1-6,9-12,17H,7-8,13-16H2 |
| InChIKey | DPPWWWISXBYIDA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|