About methoxymethane;2-methylpropane
methoxymethane;2-methylpropane (PubChem CID 18462798) has the molecular formula C6H16O
and a molecular weight of 104.19 g/mol. Its IUPAC name is methoxymethane;2-methylpropane.
Molecular Properties
| Compound Name | methoxymethane;2-methylpropane |
| PubChem CID | 18462798 |
| Molecular Formula | C6H16O |
| Molecular Weight | 104.19 g/mol |
| Exact Mass | 104.12 |
| IUPAC Name | methoxymethane;2-methylpropane |
| SMILES | CC(C)C.COC |
| InChI | InChI=1S/C4H10.C2H6O/c1-4(2)3;1-3-2/h4H,1-3H3;1-2H3 |
| InChIKey | FSZYQSOGCOXSPA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methoxymethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;2-methylpropane?
The IUPAC name of methoxymethane;2-methylpropane (CID 18462798) is methoxymethane;2-methylpropane.
What is the SMILES notation for methoxymethane;2-methylpropane?
The canonical SMILES for methoxymethane;2-methylpropane is CC(C)C.COC.
What is the InChIKey of methoxymethane;2-methylpropane?
The InChIKey is FSZYQSOGCOXSPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C2H6O/c1-4(2)3;1-3-2/h4H,1-3H3;1-2H3.
What are the key properties of methoxymethane;2-methylpropane?
methoxymethane;2-methylpropane has a molecular weight of 104.19 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;2-methylpropane is sourced from PubChem (CID 18462798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).