About tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid
tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid (PubChem CID 18462802) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid |
| PubChem CID | 18462802 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid |
| SMILES | C=C(CC(C)(C)C)C(=O)O.C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H14O2.C7H12O2/c1-6(7(9)10)5-8(2,3)4;1-5-6(8)9-7(2,3)4/h1,5H2,2-4H3,(H,9,10);5H,1H2,2-4H3 |
| InChIKey | CITRJBQBPOWLDB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid?
The IUPAC name of tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid (CID 18462802) is tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid.
What is the SMILES notation for tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid?
The canonical SMILES for tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid is C=C(CC(C)(C)C)C(=O)O.C=CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid?
The InChIKey is CITRJBQBPOWLDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C7H12O2/c1-6(7(9)10)5-8(2,3)4;1-5-6(8)9-7(2,3)4/h1,5H2,2-4H3,(H,9,10);5H,1H2,2-4H3.
What are the key properties of tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid?
tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid has a molecular weight of 270.37 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;4,4-dimethyl-2-methylidenepentanoic acid is sourced from PubChem (CID 18462802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).