2-hydroxy-2-pentylheptanoic acid

C12H24O3 — CID 18462857

IUPAC2-hydroxy-2-pentylheptanoic acid
SMILESCCCCCC(O)(CCCCC)C(=O)O
InChIInChI=1S/C12H24O3/c1-3-5-7-9-12(15,11(13)14)10-8-6-4-2/h15H,3-10H2,1-2H3,(H,13,14)
InChIKeyUNBWNTLSFASFGN-UHFFFAOYSA-N
MW216.32 g/mol
LogP2.96
Rot. Bonds9

About 2-hydroxy-2-pentylheptanoic acid

2-hydroxy-2-pentylheptanoic acid (PubChem CID 18462857) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-hydroxy-2-pentylheptanoic acid.

Molecular Properties

Compound Name2-hydroxy-2-pentylheptanoic acid
PubChem CID18462857
Molecular FormulaC12H24O3
Molecular Weight216.32 g/mol
Exact Mass216.17
IUPAC Name2-hydroxy-2-pentylheptanoic acid
SMILESCCCCCC(O)(CCCCC)C(=O)O
InChIInChI=1S/C12H24O3/c1-3-5-7-9-12(15,11(13)14)10-8-6-4-2/h15H,3-10H2,1-2H3,(H,13,14)
InChIKeyUNBWNTLSFASFGN-UHFFFAOYSA-N
XLogP2.96
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.32
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hydroxy-2-pentylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-dodecyl-2-hydroxytricosanoic acid
CID 163058779
2-hydroxy-2-pentyloctanoic acid
CID 18462834
2-ethyl-2-hydroxyoctadecanoic acid
CID 23182335
2-hydroxy-2-icosylbutanedioic acid
CID 18762279
2-ethyl-2-hydroxyhexanoic acid
CID 20700530
2-hydroxy-2-methylheptadecanoic acid
CID 19591844
(2R)-2-hydroxy-2-methyloctadecanoic acid
CID 172684339
2,3-dihexyl-2,3-dihydroxybutanedioic acid
CID 18506288
2,3-dihydroxy-2,3-dioctadecylbutanedioic acid
CID 87193003
2-hydroxy-2-iodoheptanoic acid
CID 121471870
2,2-dihydroxyoctadecanoic acid;zinc
CID 159899986
2-hexyl-2-hydroxyoctanethioic S-acid
CID 88618272

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-2-pentylheptanoic acid?
The IUPAC name of 2-hydroxy-2-pentylheptanoic acid (CID 18462857) is 2-hydroxy-2-pentylheptanoic acid.
What is the SMILES notation for 2-hydroxy-2-pentylheptanoic acid?
The canonical SMILES for 2-hydroxy-2-pentylheptanoic acid is CCCCCC(O)(CCCCC)C(=O)O.
What is the InChIKey of 2-hydroxy-2-pentylheptanoic acid?
The InChIKey is UNBWNTLSFASFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-3-5-7-9-12(15,11(13)14)10-8-6-4-2/h15H,3-10H2,1-2H3,(H,13,14).
What are the key properties of 2-hydroxy-2-pentylheptanoic acid?
2-hydroxy-2-pentylheptanoic acid has a molecular weight of 216.32 g/mol, XLogP of 2.96, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-pentylheptanoic acid is sourced from PubChem (CID 18462857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).