About 2,5-dihydropyrrole-1,3-dicarboxylic acid
2,5-dihydropyrrole-1,3-dicarboxylic acid (PubChem CID 18463030) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is 2,5-dihydropyrrole-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,5-dihydropyrrole-1,3-dicarboxylic acid |
| PubChem CID | 18463030 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2,5-dihydropyrrole-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1=CCN(C(=O)O)C1 |
| InChI | InChI=1S/C6H7NO4/c8-5(9)4-1-2-7(3-4)6(10)11/h1H,2-3H2,(H,8,9)(H,10,11) |
| InChIKey | XRUAYOALCCFEAE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dihydropyrrole-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydropyrrole-1,3-dicarboxylic acid?
The IUPAC name of 2,5-dihydropyrrole-1,3-dicarboxylic acid (CID 18463030) is 2,5-dihydropyrrole-1,3-dicarboxylic acid.
What is the SMILES notation for 2,5-dihydropyrrole-1,3-dicarboxylic acid?
The canonical SMILES for 2,5-dihydropyrrole-1,3-dicarboxylic acid is O=C(O)C1=CCN(C(=O)O)C1.
What is the InChIKey of 2,5-dihydropyrrole-1,3-dicarboxylic acid?
The InChIKey is XRUAYOALCCFEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO4/c8-5(9)4-1-2-7(3-4)6(10)11/h1H,2-3H2,(H,8,9)(H,10,11).
What are the key properties of 2,5-dihydropyrrole-1,3-dicarboxylic acid?
2,5-dihydropyrrole-1,3-dicarboxylic acid has a molecular weight of 157.12 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydropyrrole-1,3-dicarboxylic acid is sourced from PubChem (CID 18463030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).