About hexan-3-ylazanium
hexan-3-ylazanium (PubChem CID 18463188) has the molecular formula C6H16N+
and a molecular weight of 102.20 g/mol. Its IUPAC name is hexan-3-ylazanium.
Molecular Properties
| Compound Name | hexan-3-ylazanium |
| PubChem CID | 18463188 |
| Molecular Formula | C6H16N+ |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.13 |
| IUPAC Name | hexan-3-ylazanium |
| SMILES | CCCC([NH3+])CC |
| InChI | InChI=1S/C6H15N/c1-3-5-6(7)4-2/h6H,3-5,7H2,1-2H3/p+1 |
| InChIKey | HQLZFBUAULNEGP-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexan-3-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-ylazanium?
The IUPAC name of hexan-3-ylazanium (CID 18463188) is hexan-3-ylazanium.
What is the SMILES notation for hexan-3-ylazanium?
The canonical SMILES for hexan-3-ylazanium is CCCC([NH3+])CC.
What is the InChIKey of hexan-3-ylazanium?
The InChIKey is HQLZFBUAULNEGP-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N/c1-3-5-6(7)4-2/h6H,3-5,7H2,1-2H3/p+1.
What are the key properties of hexan-3-ylazanium?
hexan-3-ylazanium has a molecular weight of 102.20 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-ylazanium is sourced from PubChem (CID 18463188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).