C15H11F3N2O2S2 — CID 18463790
5-(4-methylsulfonylphenyl)-4-thiophen-3-yl-2-(trifluoromethyl)-1H-imidazole (PubChem CID 18463790) has the molecular formula C15H11F3N2O2S2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-4-thiophen-3-yl-2-(trifluoromethyl)-1H-imidazole.
| Compound Name | 5-(4-methylsulfonylphenyl)-4-thiophen-3-yl-2-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 18463790 |
| Molecular Formula | C15H11F3N2O2S2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-4-thiophen-3-yl-2-(trifluoromethyl)-1H-imidazole |
| SMILES | CS(=O)(=O)c1ccc(-c2[nH]c(C(F)(F)F)nc2-c2ccsc2)cc1 |
| InChI | InChI=1S/C15H11F3N2O2S2/c1-24(21,22)11-4-2-9(3-5-11)12-13(10-6-7-23-8-10)20-14(19-12)15(16,17)18/h2-8H,1H3,(H,19,20) |
| InChIKey | SFWUIPYCGOKQGU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |