C24H27N5O7 — CID 18463940
3-[[2-[6-(isoquinoline-1-carbonylamino)-3,7-dioxo-2-propyldiazepan-1-yl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 18463940) has the molecular formula C24H27N5O7 and a molecular weight of 497.51 g/mol. Its IUPAC name is 3-[[2-[6-(isoquinoline-1-carbonylamino)-3,7-dioxo-2-propyldiazepan-1-yl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[6-(isoquinoline-1-carbonylamino)-3,7-dioxo-2-propyldiazepan-1-yl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18463940 |
| Molecular Formula | C24H27N5O7 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 3-[[2-[6-(isoquinoline-1-carbonylamino)-3,7-dioxo-2-propyldiazepan-1-yl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CCCN1C(=O)CCC(NC(=O)c2nccc3ccccc23)C(=O)N1CC(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C24H27N5O7/c1-2-11-28-20(32)8-7-18(24(36)29(28)13-19(31)26-16(14-30)12-21(33)34)27-23(35)22-17-6-4-3-5-15(17)9-10-25-22/h3-6,9-10,14,16,18H,2,7-8,11-13H2,1H3,(H,26,31)(H,27,35)(H,33,34) |
| InChIKey | BDQPMXJGBVRSSH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|