About 2-methylidenebutanamide;morpholine
2-methylidenebutanamide;morpholine (PubChem CID 18464086) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methylidenebutanamide;morpholine.
Molecular Properties
| Compound Name | 2-methylidenebutanamide;morpholine |
| PubChem CID | 18464086 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-methylidenebutanamide;morpholine |
| SMILES | C1COCCN1.C=C(CC)C(N)=O |
| InChI | InChI=1S/C5H9NO.C4H9NO/c1-3-4(2)5(6)7;1-3-6-4-2-5-1/h2-3H2,1H3,(H2,6,7);5H,1-4H2 |
| InChIKey | XJWGZPWIDQMDEL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanamide;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanamide;morpholine?
The IUPAC name of 2-methylidenebutanamide;morpholine (CID 18464086) is 2-methylidenebutanamide;morpholine.
What is the SMILES notation for 2-methylidenebutanamide;morpholine?
The canonical SMILES for 2-methylidenebutanamide;morpholine is C1COCCN1.C=C(CC)C(N)=O.
What is the InChIKey of 2-methylidenebutanamide;morpholine?
The InChIKey is XJWGZPWIDQMDEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H9NO/c1-3-4(2)5(6)7;1-3-6-4-2-5-1/h2-3H2,1H3,(H2,6,7);5H,1-4H2.
What are the key properties of 2-methylidenebutanamide;morpholine?
2-methylidenebutanamide;morpholine has a molecular weight of 186.25 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanamide;morpholine is sourced from PubChem (CID 18464086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).