C19H10F16N2O2 — CID 18465612
2-amino-4-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol (PubChem CID 18465612) has the molecular formula C19H10F16N2O2 and a molecular weight of 602.27 g/mol. Its IUPAC name is 2-amino-4-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol.
| Compound Name | 2-amino-4-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol |
|---|---|
| PubChem CID | 18465612 |
| Molecular Formula | C19H10F16N2O2 |
| Molecular Weight | 602.27 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | 2-amino-4-[2-[3-amino-4-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-6-(1,1,2,2,2-pentafluoroethyl)phenol |
| SMILES | Nc1cc(C(c2cc(N)c(O)c(C(F)(F)C(F)(F)F)c2)(C(F)(F)F)C(F)(F)F)cc(C(F)(F)C(F)(F)F)c1O |
| InChI | InChI=1S/C19H10F16N2O2/c20-14(21,18(30,31)32)7-1-5(3-9(36)11(7)38)13(16(24,25)26,17(27,28)29)6-2-8(12(39)10(37)4-6)15(22,23)19(33,34)35/h1-4,38-39H,36-37H2 |
| InChIKey | GCPBXBPTVLXELM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.27 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|