C6H7NO3 — CID 18465927
ethyl 1,3-oxazole-2-carboxylate (PubChem CID 18465927) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is ethyl 1,3-oxazole-2-carboxylate.
| Compound Name | ethyl 1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 18465927 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | ethyl 1,3-oxazole-2-carboxylate |
| SMILES | CCOC(=O)c1ncco1 |
| InChI | InChI=1S/C6H7NO3/c1-2-9-6(8)5-7-3-4-10-5/h3-4H,2H2,1H3 |
| InChIKey | JYQRCIRWXOYCLA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |