C25H22FN5O2 — CID 18466627
2-ethyl-5-(fluoromethyl)-13-(2-quinolin-4-yloxyethyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 18466627) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-ethyl-5-(fluoromethyl)-13-(2-quinolin-4-yloxyethyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-5-(fluoromethyl)-13-(2-quinolin-4-yloxyethyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 18466627 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-ethyl-5-(fluoromethyl)-13-(2-quinolin-4-yloxyethyl)-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2nc(CF)ccc2NC(=O)c2cc(CCOc3ccnc4ccccc34)cnc21 |
| InChI | InChI=1S/C25H22FN5O2/c1-2-31-23-19(25(32)30-21-8-7-17(14-26)29-24(21)31)13-16(15-28-23)10-12-33-22-9-11-27-20-6-4-3-5-18(20)22/h3-9,11,13,15H,2,10,12,14H2,1H3,(H,30,32) |
| InChIKey | JHWPCUYVDSRWBE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |