About 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone
1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone (PubChem CID 18466677) has the molecular formula C10H13F3N2O
and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone |
| PubChem CID | 18466677 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(C(C)C)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O/c1-6(2)9-4-8(7(3)16)14-15(9)5-10(11,12)13/h4,6H,5H2,1-3H3 |
| InChIKey | NSGBJPDOWSUJKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone?
The IUPAC name of 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone (CID 18466677) is 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone.
What is the SMILES notation for 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone?
The canonical SMILES for 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone is CC(=O)c1cc(C(C)C)n(CC(F)(F)F)n1.
What is the InChIKey of 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone?
The InChIKey is NSGBJPDOWSUJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O/c1-6(2)9-4-8(7(3)16)14-15(9)5-10(11,12)13/h4,6H,5H2,1-3H3.
What are the key properties of 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone?
1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone has a molecular weight of 234.22 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]ethanone is sourced from PubChem (CID 18466677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).