C17H21F3N2O2 — CID 18466702
(2E,4E,6E)-3-methyl-7-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]octa-2,4,6-trienoic acid (PubChem CID 18466702) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is (2E,4E,6E)-3-methyl-7-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]octa-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-3-methyl-7-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 18466702 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2E,4E,6E)-3-methyl-7-[5-propan-2-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]octa-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(\C)c1cc(C(C)C)n(CC(F)(F)F)n1)=C\C(=O)O |
| InChI | InChI=1S/C17H21F3N2O2/c1-11(2)15-9-14(21-22(15)10-17(18,19)20)13(4)7-5-6-12(3)8-16(23)24/h5-9,11H,10H2,1-4H3,(H,23,24)/b6-5+,12-8+,13-7+ |
| InChIKey | GCUWSCDZXPZLLG-CKSAFXSBSA-N |
| XLogP | 4.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|