C20H20N2O4 — CID 18467163
1-butyl-4-(4-methoxyphenyl)-2-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 18467163) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-butyl-4-(4-methoxyphenyl)-2-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-butyl-4-(4-methoxyphenyl)-2-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18467163 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-butyl-4-(4-methoxyphenyl)-2-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CCCCn1c(=O)c(C(=O)O)c(-c2ccc(OC)cc2)c2cccnc21 |
| InChI | InChI=1S/C20H20N2O4/c1-3-4-12-22-18-15(6-5-11-21-18)16(17(19(22)23)20(24)25)13-7-9-14(26-2)10-8-13/h5-11H,3-4,12H2,1-2H3,(H,24,25) |
| InChIKey | XVOIRVSJHSWWCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |