C27H30FN3O5 — CID 18467304
(E)-but-2-enedioic acid;3-[1-[2-(1,3-dihydroisoindol-2-yl)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole (PubChem CID 18467304) has the molecular formula C27H30FN3O5 and a molecular weight of 495.55 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[1-[2-(1,3-dihydroisoindol-2-yl)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole.
| Compound Name | (E)-but-2-enedioic acid;3-[1-[2-(1,3-dihydroisoindol-2-yl)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 18467304 |
| Molecular Formula | C27H30FN3O5 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[1-[2-(1,3-dihydroisoindol-2-yl)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
| SMILES | CC(CN1CCC(c2noc3cc(F)ccc23)CC1)N1Cc2ccccc2C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H26FN3O.C4H4O4/c1-16(27-14-18-4-2-3-5-19(18)15-27)13-26-10-8-17(9-11-26)23-21-7-6-20(24)12-22(21)28-25-23;5-3(6)1-2-4(7)8/h2-7,12,16-17H,8-11,13-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IYKJLURKWHFODO-WLHGVMLRSA-N |
| XLogP | 4.26 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|