C37H41NO10S — CID 18467394
2-[4-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-ynyl]isoindole-1,3-dione (PubChem CID 18467394) has the molecular formula C37H41NO10S and a molecular weight of 691.80 g/mol. Its IUPAC name is 2-[4-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18467394 |
| Molecular Formula | C37H41NO10S |
| Molecular Weight | 691.80 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | 2-[4-[2-propoxy-3-propylsulfonyl-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenoxy]but-2-ynyl]isoindole-1,3-dione |
| SMILES | CCCOc1c(OCC#CCN2C(=O)c3ccccc3C2=O)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CCC |
| InChI | InChI=1S/C37H41NO10S/c1-6-17-47-35-32(46-18-11-10-16-38-36(39)26-12-8-9-13-27(26)37(38)40)22-25(23-33(35)49(41,42)19-7-2)29-15-14-28(48-29)24-20-30(43-3)34(45-5)31(21-24)44-4/h8-9,12-13,20-23,28-29H,6-7,14-19H2,1-5H3 |
| InChIKey | KESUTKSFJZVFBB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|