2-methyl-1,1-dioxothiolane-2-carboxylic acid

C6H10O4S — CID 18467934

IUPAC2-methyl-1,1-dioxothiolane-2-carboxylic acid
SMILESCC1(C(=O)O)CCCS1(=O)=O
InChIInChI=1S/C6H10O4S/c1-6(5(7)8)3-2-4-11(6,9)10/h2-4H2,1H3,(H,7,8)
InChIKeyPAFFRZYIBZKWRJ-UHFFFAOYSA-N
MW178.21 g/mol
LogP0.04
Rot. Bonds1

About 2-methyl-1,1-dioxothiolane-2-carboxylic acid

2-methyl-1,1-dioxothiolane-2-carboxylic acid (PubChem CID 18467934) has the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. Its IUPAC name is 2-methyl-1,1-dioxothiolane-2-carboxylic acid.

Molecular Properties

Compound Name2-methyl-1,1-dioxothiolane-2-carboxylic acid
PubChem CID18467934
Molecular FormulaC6H10O4S
Molecular Weight178.21 g/mol
Exact Mass178.03
IUPAC Name2-methyl-1,1-dioxothiolane-2-carboxylic acid
SMILESCC1(C(=O)O)CCCS1(=O)=O
InChIInChI=1S/C6H10O4S/c1-6(5(7)8)3-2-4-11(6,9)10/h2-4H2,1H3,(H,7,8)
InChIKeyPAFFRZYIBZKWRJ-UHFFFAOYSA-N
XLogP0.04
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.21
LogP ≤ 50.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-1,1-dioxothiolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-1,1-dioxothiolane-2-carboxylic acid?
The IUPAC name of 2-methyl-1,1-dioxothiolane-2-carboxylic acid (CID 18467934) is 2-methyl-1,1-dioxothiolane-2-carboxylic acid.
What is the SMILES notation for 2-methyl-1,1-dioxothiolane-2-carboxylic acid?
The canonical SMILES for 2-methyl-1,1-dioxothiolane-2-carboxylic acid is CC1(C(=O)O)CCCS1(=O)=O.
What is the InChIKey of 2-methyl-1,1-dioxothiolane-2-carboxylic acid?
The InChIKey is PAFFRZYIBZKWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4S/c1-6(5(7)8)3-2-4-11(6,9)10/h2-4H2,1H3,(H,7,8).
What are the key properties of 2-methyl-1,1-dioxothiolane-2-carboxylic acid?
2-methyl-1,1-dioxothiolane-2-carboxylic acid has a molecular weight of 178.21 g/mol, XLogP of 0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,1-dioxothiolane-2-carboxylic acid is sourced from PubChem (CID 18467934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).