C21H19F3N2O4 — CID 18468745
ethyl 1-(benzylamino)isoquinoline-7-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 18468745) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is ethyl 1-(benzylamino)isoquinoline-7-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 1-(benzylamino)isoquinoline-7-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18468745 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl 1-(benzylamino)isoquinoline-7-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1ccc2ccnc(NCc3ccccc3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H18N2O2.C2HF3O2/c1-2-23-19(22)16-9-8-15-10-11-20-18(17(15)12-16)21-13-14-6-4-3-5-7-14;3-2(4,5)1(6)7/h3-12H,2,13H2,1H3,(H,20,21);(H,6,7) |
| InChIKey | DCSFLYGWWGDZKT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |