About azane;bicyclo[2.2.1]hept-1-ene
azane;bicyclo[2.2.1]hept-1-ene (PubChem CID 18468857) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is azane;bicyclo[2.2.1]hept-1-ene.
Molecular Properties
| Compound Name | azane;bicyclo[2.2.1]hept-1-ene |
| PubChem CID | 18468857 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | azane;bicyclo[2.2.1]hept-1-ene |
| SMILES | C1=C2CCC(C1)C2.N |
| InChI | InChI=1S/C7H10.H3N/c1-2-7-4-3-6(1)5-7;/h1,7H,2-5H2;1H3 |
| InChIKey | VZRZCMSFCWZRDP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;bicyclo[2.2.1]hept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bicyclo[2.2.1]hept-1-ene?
The IUPAC name of azane;bicyclo[2.2.1]hept-1-ene (CID 18468857) is azane;bicyclo[2.2.1]hept-1-ene.
What is the SMILES notation for azane;bicyclo[2.2.1]hept-1-ene?
The canonical SMILES for azane;bicyclo[2.2.1]hept-1-ene is C1=C2CCC(C1)C2.N.
What is the InChIKey of azane;bicyclo[2.2.1]hept-1-ene?
The InChIKey is VZRZCMSFCWZRDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.H3N/c1-2-7-4-3-6(1)5-7;/h1,7H,2-5H2;1H3.
What are the key properties of azane;bicyclo[2.2.1]hept-1-ene?
azane;bicyclo[2.2.1]hept-1-ene has a molecular weight of 111.19 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bicyclo[2.2.1]hept-1-ene is sourced from PubChem (CID 18468857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).