C16H21ClSi — CID 18468872
chloro-(2,3-dimethyl-1,5,6,7-tetrahydro-s-indacen-1-yl)-dimethylsilane (PubChem CID 18468872) has the molecular formula C16H21ClSi and a molecular weight of 276.88 g/mol. Its IUPAC name is chloro-(2,3-dimethyl-1,5,6,7-tetrahydro-s-indacen-1-yl)-dimethylsilane.
| Compound Name | chloro-(2,3-dimethyl-1,5,6,7-tetrahydro-s-indacen-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 18468872 |
| Molecular Formula | C16H21ClSi |
| Molecular Weight | 276.88 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | chloro-(2,3-dimethyl-1,5,6,7-tetrahydro-s-indacen-1-yl)-dimethylsilane |
| SMILES | CC1=C(C)C([Si](C)(C)Cl)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C16H21ClSi/c1-10-11(2)16(18(3,4)17)15-9-13-7-5-6-12(13)8-14(10)15/h8-9,16H,5-7H2,1-4H3 |
| InChIKey | DBPUPDSXMRQMFB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|