C8H10N2O3 — CID 18468954
2-(3-amino-6-methyl-2-oxo-1-pyridinyl)acetic acid (PubChem CID 18468954) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(3-amino-6-methyl-2-oxo-1-pyridinyl)acetic acid.
| Compound Name | 2-(3-amino-6-methyl-2-oxo-1-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 18468954 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(3-amino-6-methyl-2-oxo-1-pyridinyl)acetic acid |
| SMILES | Cc1ccc(N)c(=O)n1CC(=O)O |
| InChI | InChI=1S/C8H10N2O3/c1-5-2-3-6(9)8(13)10(5)4-7(11)12/h2-3H,4,9H2,1H3,(H,11,12) |
| InChIKey | QADNMJOLBFLESP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |