C35H34O4S2 — CID 18469762
4-benzylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium (PubChem CID 18469762) has the molecular formula C35H34O4S2 and a molecular weight of 582.79 g/mol. Its IUPAC name is 4-benzylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium.
| Compound Name | 4-benzylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 18469762 |
| Molecular Formula | C35H34O4S2 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 4-benzylbenzenesulfonate;[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23OS.C13H12O3S/c1-22(2,3)23-18-14-16-21(17-15-18)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20;14-17(15,16)13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h4-17H,1-3H3;1-9H,10H2,(H,14,15,16)/q+1;/p-1 |
| InChIKey | QMSJEUYJMHOCHI-UHFFFAOYSA-M |
| XLogP | 8.14 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|